C14H12Br2N2O — CID 107937331
N-(3-amino-4-methylphenyl)-2,4-dibromobenzamide (PubChem CID 107937331) has the molecular formula C14H12Br2N2O and a molecular weight of 384.07 g/mol. Its IUPAC name is N-(3-amino-4-methylphenyl)-2,4-dibromobenzamide.
| Compound Name | N-(3-amino-4-methylphenyl)-2,4-dibromobenzamide |
|---|---|
| PubChem CID | 107937331 |
| Molecular Formula | C14H12Br2N2O |
| Molecular Weight | 384.07 g/mol |
| Exact Mass | 381.93 |
| IUPAC Name | N-(3-amino-4-methylphenyl)-2,4-dibromobenzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(Br)cc2Br)cc1N |
| InChI | InChI=1S/C14H12Br2N2O/c1-8-2-4-10(7-13(8)17)18-14(19)11-5-3-9(15)6-12(11)16/h2-7H,17H2,1H3,(H,18,19) |
| InChIKey | LRKZFHPNXXUUDE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.07 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|