C13H7Br3ClNO — CID 107939196
2,4-dibromo-N-(3-bromo-4-chlorophenyl)benzamide (PubChem CID 107939196) has the molecular formula C13H7Br3ClNO and a molecular weight of 468.37 g/mol. Its IUPAC name is 2,4-dibromo-N-(3-bromo-4-chlorophenyl)benzamide.
| Compound Name | 2,4-dibromo-N-(3-bromo-4-chlorophenyl)benzamide |
|---|---|
| PubChem CID | 107939196 |
| Molecular Formula | C13H7Br3ClNO |
| Molecular Weight | 468.37 g/mol |
| Exact Mass | 464.78 |
| IUPAC Name | 2,4-dibromo-N-(3-bromo-4-chlorophenyl)benzamide |
| SMILES | O=C(Nc1ccc(Cl)c(Br)c1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C13H7Br3ClNO/c14-7-1-3-9(10(15)5-7)13(19)18-8-2-4-12(17)11(16)6-8/h1-6H,(H,18,19) |
| InChIKey | QLVPQTFGSWDXHX-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.37 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |