C13H7Br2FN2O3 — CID 103886725
2,4-dibromo-N-(3-fluoro-4-nitrophenyl)benzamide (PubChem CID 103886725) has the molecular formula C13H7Br2FN2O3 and a molecular weight of 418.02 g/mol. Its IUPAC name is 2,4-dibromo-N-(3-fluoro-4-nitrophenyl)benzamide.
| Compound Name | 2,4-dibromo-N-(3-fluoro-4-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 103886725 |
| Molecular Formula | C13H7Br2FN2O3 |
| Molecular Weight | 418.02 g/mol |
| Exact Mass | 415.88 |
| IUPAC Name | 2,4-dibromo-N-(3-fluoro-4-nitrophenyl)benzamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])c(F)c1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C13H7Br2FN2O3/c14-7-1-3-9(10(15)5-7)13(19)17-8-2-4-12(18(20)21)11(16)6-8/h1-6H,(H,17,19) |
| InChIKey | ONPSAOLNIGQADY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.02 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|