C13H9Br2NO3 — CID 91678298
(E)-3-[5-(2,4-dibromophenyl)furan-2-yl]-N-hydroxyprop-2-enamide (PubChem CID 91678298) has the molecular formula C13H9Br2NO3 and a molecular weight of 387.03 g/mol. Its IUPAC name is (E)-3-[5-(2,4-dibromophenyl)furan-2-yl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[5-(2,4-dibromophenyl)furan-2-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 91678298 |
| Molecular Formula | C13H9Br2NO3 |
| Molecular Weight | 387.03 g/mol |
| Exact Mass | 384.89 |
| IUPAC Name | (E)-3-[5-(2,4-dibromophenyl)furan-2-yl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2ccc(Br)cc2Br)o1)NO |
| InChI | InChI=1S/C13H9Br2NO3/c14-8-1-4-10(11(15)7-8)12-5-2-9(19-12)3-6-13(17)16-18/h1-7,18H,(H,16,17)/b6-3+ |
| InChIKey | CLRPUNMFUQVMKZ-ZZXKWVIFSA-N |
| XLogP | 3.99 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.03 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|