methyl 5-(2,4-dibromophenyl)furan-2-carboxylate

C12H8Br2O3 — CID 95910400

IUPACmethyl 5-(2,4-dibromophenyl)furan-2-carboxylate
SMILESCOC(=O)c1ccc(-c2ccc(Br)cc2Br)o1
InChIInChI=1S/C12H8Br2O3/c1-16-12(15)11-5-4-10(17-11)8-3-2-7(13)6-9(8)14/h2-6H,1H3
InChIKeyLNPARCVKYLZGPE-UHFFFAOYSA-N
MW360.00 g/mol
LogP4.26
Rot. Bonds2

About methyl 5-(2,4-dibromophenyl)furan-2-carboxylate

methyl 5-(2,4-dibromophenyl)furan-2-carboxylate (PubChem CID 95910400) has the molecular formula C12H8Br2O3 and a molecular weight of 360.00 g/mol. Its IUPAC name is methyl 5-(2,4-dibromophenyl)furan-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-(2,4-dibromophenyl)furan-2-carboxylate
PubChem CID95910400
Molecular FormulaC12H8Br2O3
Molecular Weight360.00 g/mol
Exact Mass357.88
IUPAC Namemethyl 5-(2,4-dibromophenyl)furan-2-carboxylate
SMILESCOC(=O)c1ccc(-c2ccc(Br)cc2Br)o1
InChIInChI=1S/C12H8Br2O3/c1-16-12(15)11-5-4-10(17-11)8-3-2-7(13)6-9(8)14/h2-6H,1H3
InChIKeyLNPARCVKYLZGPE-UHFFFAOYSA-N
XLogP4.26
TPSA39.44 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500360.00
LogP ≤ 54.26
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 5-(2,4-dibromophenyl)furan-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-(2,4-dibromophenyl)furan-2-carboxylate?
The IUPAC name of methyl 5-(2,4-dibromophenyl)furan-2-carboxylate (CID 95910400) is methyl 5-(2,4-dibromophenyl)furan-2-carboxylate.
What is the SMILES notation for methyl 5-(2,4-dibromophenyl)furan-2-carboxylate?
The canonical SMILES for methyl 5-(2,4-dibromophenyl)furan-2-carboxylate is COC(=O)c1ccc(-c2ccc(Br)cc2Br)o1.
What is the InChIKey of methyl 5-(2,4-dibromophenyl)furan-2-carboxylate?
The InChIKey is LNPARCVKYLZGPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Br2O3/c1-16-12(15)11-5-4-10(17-11)8-3-2-7(13)6-9(8)14/h2-6H,1H3.
What are the key properties of methyl 5-(2,4-dibromophenyl)furan-2-carboxylate?
methyl 5-(2,4-dibromophenyl)furan-2-carboxylate has a molecular weight of 360.00 g/mol, XLogP of 4.26, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(2,4-dibromophenyl)furan-2-carboxylate is sourced from PubChem (CID 95910400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).