C12H8Br2O3 — CID 95910400
methyl 5-(2,4-dibromophenyl)furan-2-carboxylate (PubChem CID 95910400) has the molecular formula C12H8Br2O3 and a molecular weight of 360.00 g/mol. Its IUPAC name is methyl 5-(2,4-dibromophenyl)furan-2-carboxylate.
| Compound Name | methyl 5-(2,4-dibromophenyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 95910400 |
| Molecular Formula | C12H8Br2O3 |
| Molecular Weight | 360.00 g/mol |
| Exact Mass | 357.88 |
| IUPAC Name | methyl 5-(2,4-dibromophenyl)furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(-c2ccc(Br)cc2Br)o1 |
| InChI | InChI=1S/C12H8Br2O3/c1-16-12(15)11-5-4-10(17-11)8-3-2-7(13)6-9(8)14/h2-6H,1H3 |
| InChIKey | LNPARCVKYLZGPE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.00 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |