5-(2,4-dibromophenyl)furan-2-carbonyl chloride

C11H5Br2ClO2 — CID 17274076

IUPAC5-(2,4-dibromophenyl)furan-2-carbonyl chloride
SMILESO=C(Cl)c1ccc(-c2ccc(Br)cc2Br)o1
InChIInChI=1S/C11H5Br2ClO2/c12-6-1-2-7(8(13)5-6)9-3-4-10(16-9)11(14)15/h1-5H
InChIKeyAZKLHDGIBXLWNY-UHFFFAOYSA-N
MW364.42 g/mol
LogP4.85
Rot. Bonds2

About 5-(2,4-dibromophenyl)furan-2-carbonyl chloride

5-(2,4-dibromophenyl)furan-2-carbonyl chloride (PubChem CID 17274076) has the molecular formula C11H5Br2ClO2 and a molecular weight of 364.42 g/mol. Its IUPAC name is 5-(2,4-dibromophenyl)furan-2-carbonyl chloride.

Molecular Properties

Compound Name5-(2,4-dibromophenyl)furan-2-carbonyl chloride
PubChem CID17274076
Molecular FormulaC11H5Br2ClO2
Molecular Weight364.42 g/mol
Exact Mass361.83
IUPAC Name5-(2,4-dibromophenyl)furan-2-carbonyl chloride
SMILESO=C(Cl)c1ccc(-c2ccc(Br)cc2Br)o1
InChIInChI=1S/C11H5Br2ClO2/c12-6-1-2-7(8(13)5-6)9-3-4-10(16-9)11(14)15/h1-5H
InChIKeyAZKLHDGIBXLWNY-UHFFFAOYSA-N
XLogP4.85
TPSA30.21 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500364.42
LogP ≤ 54.85
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 5-(2,4-dibromophenyl)furan-2-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2,4-dibromophenyl)furan-2-carbonyl chloride?
The IUPAC name of 5-(2,4-dibromophenyl)furan-2-carbonyl chloride (CID 17274076) is 5-(2,4-dibromophenyl)furan-2-carbonyl chloride.
What is the SMILES notation for 5-(2,4-dibromophenyl)furan-2-carbonyl chloride?
The canonical SMILES for 5-(2,4-dibromophenyl)furan-2-carbonyl chloride is O=C(Cl)c1ccc(-c2ccc(Br)cc2Br)o1.
What is the InChIKey of 5-(2,4-dibromophenyl)furan-2-carbonyl chloride?
The InChIKey is AZKLHDGIBXLWNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5Br2ClO2/c12-6-1-2-7(8(13)5-6)9-3-4-10(16-9)11(14)15/h1-5H.
What are the key properties of 5-(2,4-dibromophenyl)furan-2-carbonyl chloride?
5-(2,4-dibromophenyl)furan-2-carbonyl chloride has a molecular weight of 364.42 g/mol, XLogP of 4.85, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-dibromophenyl)furan-2-carbonyl chloride is sourced from PubChem (CID 17274076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).