C20H13Br2N3O3 — CID 100817382
1-[5-(2,4-dibromophenyl)furan-2-carbonyl]indole-3-carbohydrazide (PubChem CID 100817382) has the molecular formula C20H13Br2N3O3 and a molecular weight of 503.15 g/mol. Its IUPAC name is 1-[5-(2,4-dibromophenyl)furan-2-carbonyl]indole-3-carbohydrazide.
| Compound Name | 1-[5-(2,4-dibromophenyl)furan-2-carbonyl]indole-3-carbohydrazide |
|---|---|
| PubChem CID | 100817382 |
| Molecular Formula | C20H13Br2N3O3 |
| Molecular Weight | 503.15 g/mol |
| Exact Mass | 500.93 |
| IUPAC Name | 1-[5-(2,4-dibromophenyl)furan-2-carbonyl]indole-3-carbohydrazide |
| SMILES | NNC(=O)c1cn(C(=O)c2ccc(-c3ccc(Br)cc3Br)o2)c2ccccc12 |
| InChI | InChI=1S/C20H13Br2N3O3/c21-11-5-6-13(15(22)9-11)17-7-8-18(28-17)20(27)25-10-14(19(26)24-23)12-3-1-2-4-16(12)25/h1-10H,23H2,(H,24,26) |
| InChIKey | MMPBYTDGZGMLRI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 90.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.15 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|