C13H11Br2NO3 — CID 66527849
2-[[5-(2,4-dibromophenyl)furan-2-yl]methylamino]acetic acid (PubChem CID 66527849) has the molecular formula C13H11Br2NO3 and a molecular weight of 389.04 g/mol. Its IUPAC name is 2-[[5-(2,4-dibromophenyl)furan-2-yl]methylamino]acetic acid.
| Compound Name | 2-[[5-(2,4-dibromophenyl)furan-2-yl]methylamino]acetic acid |
|---|---|
| PubChem CID | 66527849 |
| Molecular Formula | C13H11Br2NO3 |
| Molecular Weight | 389.04 g/mol |
| Exact Mass | 386.91 |
| IUPAC Name | 2-[[5-(2,4-dibromophenyl)furan-2-yl]methylamino]acetic acid |
| SMILES | O=C(O)CNCc1ccc(-c2ccc(Br)cc2Br)o1 |
| InChI | InChI=1S/C13H11Br2NO3/c14-8-1-3-10(11(15)5-8)12-4-2-9(19-12)6-16-7-13(17)18/h1-5,16H,6-7H2,(H,17,18) |
| InChIKey | UQAVMTOHHLLRRT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.04 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |