C22H32Br2N2O — CID 17214901
N',N'-dibutyl-N-[[5-(2,4-dibromophenyl)furan-2-yl]methyl]propane-1,3-diamine (PubChem CID 17214901) has the molecular formula C22H32Br2N2O and a molecular weight of 500.32 g/mol. Its IUPAC name is N',N'-dibutyl-N-[[5-(2,4-dibromophenyl)furan-2-yl]methyl]propane-1,3-diamine.
| Compound Name | N',N'-dibutyl-N-[[5-(2,4-dibromophenyl)furan-2-yl]methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 17214901 |
| Molecular Formula | C22H32Br2N2O |
| Molecular Weight | 500.32 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | N',N'-dibutyl-N-[[5-(2,4-dibromophenyl)furan-2-yl]methyl]propane-1,3-diamine |
| SMILES | CCCCN(CCCC)CCCNCc1ccc(-c2ccc(Br)cc2Br)o1 |
| InChI | InChI=1S/C22H32Br2N2O/c1-3-5-13-26(14-6-4-2)15-7-12-25-17-19-9-11-22(27-19)20-10-8-18(23)16-21(20)24/h8-11,16,25H,3-7,12-15,17H2,1-2H3 |
| InChIKey | FBCBCIHGHKKNTO-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.32 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|