C17H22Br2ClNO — CID 17213045
N-[[5-(2,4-dibromophenyl)furan-2-yl]methyl]hexan-1-amine;hydrochloride (PubChem CID 17213045) has the molecular formula C17H22Br2ClNO and a molecular weight of 451.63 g/mol. Its IUPAC name is N-[[5-(2,4-dibromophenyl)furan-2-yl]methyl]hexan-1-amine;hydrochloride.
| Compound Name | N-[[5-(2,4-dibromophenyl)furan-2-yl]methyl]hexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17213045 |
| Molecular Formula | C17H22Br2ClNO |
| Molecular Weight | 451.63 g/mol |
| Exact Mass | 448.98 |
| IUPAC Name | N-[[5-(2,4-dibromophenyl)furan-2-yl]methyl]hexan-1-amine;hydrochloride |
| SMILES | CCCCCCNCc1ccc(-c2ccc(Br)cc2Br)o1.Cl |
| InChI | InChI=1S/C17H21Br2NO.ClH/c1-2-3-4-5-10-20-12-14-7-9-17(21-14)15-8-6-13(18)11-16(15)19;/h6-9,11,20H,2-5,10,12H2,1H3;1H |
| InChIKey | SGXJTGKJXSOHFQ-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.63 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|