C18H24BrNO — CID 17056314
N-[[5-(4-bromo-3-methylphenyl)furan-2-yl]methyl]hexan-1-amine (PubChem CID 17056314) has the molecular formula C18H24BrNO and a molecular weight of 350.30 g/mol. Its IUPAC name is N-[[5-(4-bromo-3-methylphenyl)furan-2-yl]methyl]hexan-1-amine.
| Compound Name | N-[[5-(4-bromo-3-methylphenyl)furan-2-yl]methyl]hexan-1-amine |
|---|---|
| PubChem CID | 17056314 |
| Molecular Formula | C18H24BrNO |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-[[5-(4-bromo-3-methylphenyl)furan-2-yl]methyl]hexan-1-amine |
| SMILES | CCCCCCNCc1ccc(-c2ccc(Br)c(C)c2)o1 |
| InChI | InChI=1S/C18H24BrNO/c1-3-4-5-6-11-20-13-16-8-10-18(21-16)15-7-9-17(19)14(2)12-15/h7-10,12,20H,3-6,11,13H2,1-2H3 |
| InChIKey | NLPHDYZWFBMWOB-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|