C17H25BrCl2N2O — CID 17056331
N-[[5-(4-bromo-3-methylphenyl)furan-2-yl]methyl]-N',N'-dimethylpropane-1,3-diamine;dihydrochloride (PubChem CID 17056331) has the molecular formula C17H25BrCl2N2O and a molecular weight of 424.21 g/mol. Its IUPAC name is N-[[5-(4-bromo-3-methylphenyl)furan-2-yl]methyl]-N',N'-dimethylpropane-1,3-diamine;dihydrochloride.
| Compound Name | N-[[5-(4-bromo-3-methylphenyl)furan-2-yl]methyl]-N',N'-dimethylpropane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17056331 |
| Molecular Formula | C17H25BrCl2N2O |
| Molecular Weight | 424.21 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | N-[[5-(4-bromo-3-methylphenyl)furan-2-yl]methyl]-N',N'-dimethylpropane-1,3-diamine;dihydrochloride |
| SMILES | Cc1cc(-c2ccc(CNCCCN(C)C)o2)ccc1Br.Cl.Cl |
| InChI | InChI=1S/C17H23BrN2O.2ClH/c1-13-11-14(5-7-16(13)18)17-8-6-15(21-17)12-19-9-4-10-20(2)3;;/h5-8,11,19H,4,9-10,12H2,1-3H3;2*1H |
| InChIKey | NJJFHZFVVVLVGT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.21 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|