C16H21BrClNO — CID 17056319
N-[[5-(4-bromo-3-methylphenyl)furan-2-yl]methyl]butan-2-amine;hydrochloride (PubChem CID 17056319) has the molecular formula C16H21BrClNO and a molecular weight of 358.71 g/mol. Its IUPAC name is N-[[5-(4-bromo-3-methylphenyl)furan-2-yl]methyl]butan-2-amine;hydrochloride.
| Compound Name | N-[[5-(4-bromo-3-methylphenyl)furan-2-yl]methyl]butan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 17056319 |
| Molecular Formula | C16H21BrClNO |
| Molecular Weight | 358.71 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | N-[[5-(4-bromo-3-methylphenyl)furan-2-yl]methyl]butan-2-amine;hydrochloride |
| SMILES | CCC(C)NCc1ccc(-c2ccc(Br)c(C)c2)o1.Cl |
| InChI | InChI=1S/C16H20BrNO.ClH/c1-4-12(3)18-10-14-6-8-16(19-14)13-5-7-15(17)11(2)9-13;/h5-9,12,18H,4,10H2,1-3H3;1H |
| InChIKey | HHFICERWVXMCNZ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.71 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |