C16H23Cl2FN2O — CID 17331982
N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-N',N'-dimethylpropane-1,3-diamine;dihydrochloride (PubChem CID 17331982) has the molecular formula C16H23Cl2FN2O and a molecular weight of 349.28 g/mol. Its IUPAC name is N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-N',N'-dimethylpropane-1,3-diamine;dihydrochloride.
| Compound Name | N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-N',N'-dimethylpropane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17331982 |
| Molecular Formula | C16H23Cl2FN2O |
| Molecular Weight | 349.28 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-N',N'-dimethylpropane-1,3-diamine;dihydrochloride |
| SMILES | CN(C)CCCNCc1ccc(-c2ccc(F)cc2)o1.Cl.Cl |
| InChI | InChI=1S/C16H21FN2O.2ClH/c1-19(2)11-3-10-18-12-15-8-9-16(20-15)13-4-6-14(17)7-5-13;;/h4-9,18H,3,10-12H2,1-2H3;2*1H |
| InChIKey | VVGCAWIKOPFVMX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.28 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|