C21H22BrNO2 — CID 17207474
N-[[5-(4-bromo-3-methylphenyl)furan-2-yl]methyl]-2-(2-methoxyphenyl)ethanamine (PubChem CID 17207474) has the molecular formula C21H22BrNO2 and a molecular weight of 400.32 g/mol. Its IUPAC name is N-[[5-(4-bromo-3-methylphenyl)furan-2-yl]methyl]-2-(2-methoxyphenyl)ethanamine.
| Compound Name | N-[[5-(4-bromo-3-methylphenyl)furan-2-yl]methyl]-2-(2-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 17207474 |
| Molecular Formula | C21H22BrNO2 |
| Molecular Weight | 400.32 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | N-[[5-(4-bromo-3-methylphenyl)furan-2-yl]methyl]-2-(2-methoxyphenyl)ethanamine |
| SMILES | COc1ccccc1CCNCc1ccc(-c2ccc(Br)c(C)c2)o1 |
| InChI | InChI=1S/C21H22BrNO2/c1-15-13-17(7-9-19(15)22)21-10-8-18(25-21)14-23-12-11-16-5-3-4-6-20(16)24-2/h3-10,13,23H,11-12,14H2,1-2H3 |
| InChIKey | XBGHWJQRNPBANY-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.32 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|