C20H18BrNO4 — CID 17058773
3-[[5-(4-bromo-3-methylphenyl)furan-2-yl]methylamino]-4-methoxybenzoic acid (PubChem CID 17058773) has the molecular formula C20H18BrNO4 and a molecular weight of 416.27 g/mol. Its IUPAC name is 3-[[5-(4-bromo-3-methylphenyl)furan-2-yl]methylamino]-4-methoxybenzoic acid.
| Compound Name | 3-[[5-(4-bromo-3-methylphenyl)furan-2-yl]methylamino]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 17058773 |
| Molecular Formula | C20H18BrNO4 |
| Molecular Weight | 416.27 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 3-[[5-(4-bromo-3-methylphenyl)furan-2-yl]methylamino]-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1NCc1ccc(-c2ccc(Br)c(C)c2)o1 |
| InChI | InChI=1S/C20H18BrNO4/c1-12-9-13(3-6-16(12)21)18-8-5-15(26-18)11-22-17-10-14(20(23)24)4-7-19(17)25-2/h3-10,22H,11H2,1-2H3,(H,23,24) |
| InChIKey | DSTUVYXUQSUWPZ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.27 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |