C14H14N2O5 — CID 104608517
5-[(5-carbamoyl-2-methoxyanilino)methyl]furan-3-carboxylic acid (PubChem CID 104608517) has the molecular formula C14H14N2O5 and a molecular weight of 290.28 g/mol. Its IUPAC name is 5-[(5-carbamoyl-2-methoxyanilino)methyl]furan-3-carboxylic acid.
| Compound Name | 5-[(5-carbamoyl-2-methoxyanilino)methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 104608517 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 5-[(5-carbamoyl-2-methoxyanilino)methyl]furan-3-carboxylic acid |
| SMILES | COc1ccc(C(N)=O)cc1NCc1cc(C(=O)O)co1 |
| InChI | InChI=1S/C14H14N2O5/c1-20-12-3-2-8(13(15)17)5-11(12)16-6-10-4-9(7-21-10)14(18)19/h2-5,7,16H,6H2,1H3,(H2,15,17)(H,18,19) |
| InChIKey | CNMDKXRXFVWQTR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |