C11H12N2O2 — CID 63952284
4-methoxy-3-(prop-2-ynylamino)benzamide (PubChem CID 63952284) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 4-methoxy-3-(prop-2-ynylamino)benzamide.
| Compound Name | 4-methoxy-3-(prop-2-ynylamino)benzamide |
|---|---|
| PubChem CID | 63952284 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 4-methoxy-3-(prop-2-ynylamino)benzamide |
| SMILES | C#CCNc1cc(C(N)=O)ccc1OC |
| InChI | InChI=1S/C11H12N2O2/c1-3-6-13-9-7-8(11(12)14)4-5-10(9)15-2/h1,4-5,7,13H,6H2,2H3,(H2,12,14) |
| InChIKey | HEYVTGZOYYBNPE-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|