C18H20N2O6 — CID 55783058
N-(5-carbamoyl-2-methoxyphenyl)-3,4,5-trimethoxybenzamide (PubChem CID 55783058) has the molecular formula C18H20N2O6 and a molecular weight of 360.37 g/mol. Its IUPAC name is N-(5-carbamoyl-2-methoxyphenyl)-3,4,5-trimethoxybenzamide.
| Compound Name | N-(5-carbamoyl-2-methoxyphenyl)-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 55783058 |
| Molecular Formula | C18H20N2O6 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | N-(5-carbamoyl-2-methoxyphenyl)-3,4,5-trimethoxybenzamide |
| SMILES | COc1ccc(C(N)=O)cc1NC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C18H20N2O6/c1-23-13-6-5-10(17(19)21)7-12(13)20-18(22)11-8-14(24-2)16(26-4)15(9-11)25-3/h5-9H,1-4H3,(H2,19,21)(H,20,22) |
| InChIKey | FEYQWUIXTMOTLG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |