C10H9F3N2O3 — CID 63374757
4-methoxy-3-[(2,2,2-trifluoroacetyl)amino]benzamide (PubChem CID 63374757) has the molecular formula C10H9F3N2O3 and a molecular weight of 262.19 g/mol. Its IUPAC name is 4-methoxy-3-[(2,2,2-trifluoroacetyl)amino]benzamide.
| Compound Name | 4-methoxy-3-[(2,2,2-trifluoroacetyl)amino]benzamide |
|---|---|
| PubChem CID | 63374757 |
| Molecular Formula | C10H9F3N2O3 |
| Molecular Weight | 262.19 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 4-methoxy-3-[(2,2,2-trifluoroacetyl)amino]benzamide |
| SMILES | COc1ccc(C(N)=O)cc1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H9F3N2O3/c1-18-7-3-2-5(8(14)16)4-6(7)15-9(17)10(11,12)13/h2-4H,1H3,(H2,14,16)(H,15,17) |
| InChIKey | DAQQESBIJMBUGK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.19 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |