C13H14Cl2N2O3 — CID 94005114
3-[[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]-4-methoxybenzamide (PubChem CID 94005114) has the molecular formula C13H14Cl2N2O3 and a molecular weight of 317.17 g/mol. Its IUPAC name is 3-[[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]-4-methoxybenzamide.
| Compound Name | 3-[[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]-4-methoxybenzamide |
|---|---|
| PubChem CID | 94005114 |
| Molecular Formula | C13H14Cl2N2O3 |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 3-[[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]-4-methoxybenzamide |
| SMILES | COc1ccc(C(N)=O)cc1NC(=O)[C@]1(C)CC1(Cl)Cl |
| InChI | InChI=1S/C13H14Cl2N2O3/c1-12(6-13(12,14)15)11(19)17-8-5-7(10(16)18)3-4-9(8)20-2/h3-5H,6H2,1-2H3,(H2,16,18)(H,17,19)/t12-/m0/s1 |
| InChIKey | MURJUVPFQNDSQM-LBPRGKRZSA-N |
| XLogP | 2.32 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|