C17H20Cl2N2O4 — CID 91641888
2,2-dichloro-N-[2-methoxy-5-(morpholine-4-carbonyl)phenyl]-1-methylcyclopropane-1-carboxamide (PubChem CID 91641888) has the molecular formula C17H20Cl2N2O4 and a molecular weight of 387.26 g/mol. Its IUPAC name is 2,2-dichloro-N-[2-methoxy-5-(morpholine-4-carbonyl)phenyl]-1-methylcyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-[2-methoxy-5-(morpholine-4-carbonyl)phenyl]-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 91641888 |
| Molecular Formula | C17H20Cl2N2O4 |
| Molecular Weight | 387.26 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 2,2-dichloro-N-[2-methoxy-5-(morpholine-4-carbonyl)phenyl]-1-methylcyclopropane-1-carboxamide |
| SMILES | COc1ccc(C(=O)N2CCOCC2)cc1NC(=O)C1(C)CC1(Cl)Cl |
| InChI | InChI=1S/C17H20Cl2N2O4/c1-16(10-17(16,18)19)15(23)20-12-9-11(3-4-13(12)24-2)14(22)21-5-7-25-8-6-21/h3-4,9H,5-8,10H2,1-2H3,(H,20,23) |
| InChIKey | AANOQNYJWGJELJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|