C21H23F3N2O4 — CID 75447304
[4-methoxy-3-[2-[4-(trifluoromethoxy)phenyl]ethylamino]phenyl]-morpholin-4-ylmethanone (PubChem CID 75447304) has the molecular formula C21H23F3N2O4 and a molecular weight of 424.42 g/mol. Its IUPAC name is [4-methoxy-3-[2-[4-(trifluoromethoxy)phenyl]ethylamino]phenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-methoxy-3-[2-[4-(trifluoromethoxy)phenyl]ethylamino]phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 75447304 |
| Molecular Formula | C21H23F3N2O4 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | [4-methoxy-3-[2-[4-(trifluoromethoxy)phenyl]ethylamino]phenyl]-morpholin-4-ylmethanone |
| SMILES | COc1ccc(C(=O)N2CCOCC2)cc1NCCc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H23F3N2O4/c1-28-19-7-4-16(20(27)26-10-12-29-13-11-26)14-18(19)25-9-8-15-2-5-17(6-3-15)30-21(22,23)24/h2-7,14,25H,8-13H2,1H3 |
| InChIKey | HINNZPJYNKPILQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |