C24H24F3NO5 — CID 154364609
3-(3,4-dimethoxyphenyl)-1-morpholin-4-yl-5-[4-(trifluoromethoxy)phenyl]penta-2,4-dien-1-one (PubChem CID 154364609) has the molecular formula C24H24F3NO5 and a molecular weight of 463.45 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-1-morpholin-4-yl-5-[4-(trifluoromethoxy)phenyl]penta-2,4-dien-1-one.
| Compound Name | 3-(3,4-dimethoxyphenyl)-1-morpholin-4-yl-5-[4-(trifluoromethoxy)phenyl]penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 154364609 |
| Molecular Formula | C24H24F3NO5 |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-1-morpholin-4-yl-5-[4-(trifluoromethoxy)phenyl]penta-2,4-dien-1-one |
| SMILES | COc1ccc(C(C=Cc2ccc(OC(F)(F)F)cc2)=CC(=O)N2CCOCC2)cc1OC |
| InChI | InChI=1S/C24H24F3NO5/c1-30-21-10-7-18(15-22(21)31-2)19(16-23(29)28-11-13-32-14-12-28)6-3-17-4-8-20(9-5-17)33-24(25,26)27/h3-10,15-16H,11-14H2,1-2H3 |
| InChIKey | PWLGYIAVURQRCF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|