C25H29NO4 — CID 154363882
4-(4-ethoxy-3-methoxyphenyl)-1-morpholin-4-yl-6-phenylhexa-3,5-dien-1-one (PubChem CID 154363882) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is 4-(4-ethoxy-3-methoxyphenyl)-1-morpholin-4-yl-6-phenylhexa-3,5-dien-1-one.
| Compound Name | 4-(4-ethoxy-3-methoxyphenyl)-1-morpholin-4-yl-6-phenylhexa-3,5-dien-1-one |
|---|---|
| PubChem CID | 154363882 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 4-(4-ethoxy-3-methoxyphenyl)-1-morpholin-4-yl-6-phenylhexa-3,5-dien-1-one |
| SMILES | CCOc1ccc(C(C=Cc2ccccc2)=CCC(=O)N2CCOCC2)cc1OC |
| InChI | InChI=1S/C25H29NO4/c1-3-30-23-13-11-22(19-24(23)28-2)21(10-9-20-7-5-4-6-8-20)12-14-25(27)26-15-17-29-18-16-26/h4-13,19H,3,14-18H2,1-2H3 |
| InChIKey | FXKBCOVOTXAIMY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|