C15H19NO6 — CID 5169130
3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)benzoic acid (PubChem CID 5169130) has the molecular formula C15H19NO6 and a molecular weight of 309.32 g/mol. Its IUPAC name is 3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)benzoic acid.
| Compound Name | 3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)benzoic acid |
|---|---|
| PubChem CID | 5169130 |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)benzoic acid |
| SMILES | CCOc1cc(C(=O)O)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C15H19NO6/c1-2-21-13-9-11(15(18)19)3-4-12(13)22-10-14(17)16-5-7-20-8-6-16/h3-4,9H,2,5-8,10H2,1H3,(H,18,19) |
| InChIKey | SQSVKVRFAMTGKB-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |