C19H27NO6 — CID 171349786
propan-2-yl 2-[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]acetate (PubChem CID 171349786) has the molecular formula C19H27NO6 and a molecular weight of 365.43 g/mol. Its IUPAC name is propan-2-yl 2-[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]acetate.
| Compound Name | propan-2-yl 2-[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]acetate |
|---|---|
| PubChem CID | 171349786 |
| Molecular Formula | C19H27NO6 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | propan-2-yl 2-[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]acetate |
| SMILES | CCOc1cc(CC(=O)OC(C)C)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C19H27NO6/c1-4-24-17-11-15(12-19(22)26-14(2)3)5-6-16(17)25-13-18(21)20-7-9-23-10-8-20/h5-6,11,14H,4,7-10,12-13H2,1-3H3 |
| InChIKey | XFIYEVLBTORUDX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |