C23H25NO7 — CID 18281736
phenacyl 3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)benzoate (PubChem CID 18281736) has the molecular formula C23H25NO7 and a molecular weight of 427.45 g/mol. Its IUPAC name is phenacyl 3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)benzoate.
| Compound Name | phenacyl 3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)benzoate |
|---|---|
| PubChem CID | 18281736 |
| Molecular Formula | C23H25NO7 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | phenacyl 3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)benzoate |
| SMILES | CCOc1cc(C(=O)OCC(=O)c2ccccc2)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C23H25NO7/c1-2-29-21-14-18(23(27)31-15-19(25)17-6-4-3-5-7-17)8-9-20(21)30-16-22(26)24-10-12-28-13-11-24/h3-9,14H,2,10-13,15-16H2,1H3 |
| InChIKey | RVZVQZOEFNUHAI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |