C19H23NO8 — CID 7485301
[(3R)-2-oxooxolan-3-yl] 3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)benzoate (PubChem CID 7485301) has the molecular formula C19H23NO8 and a molecular weight of 393.39 g/mol. Its IUPAC name is [(3R)-2-oxooxolan-3-yl] 3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)benzoate.
| Compound Name | [(3R)-2-oxooxolan-3-yl] 3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)benzoate |
|---|---|
| PubChem CID | 7485301 |
| Molecular Formula | C19H23NO8 |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | [(3R)-2-oxooxolan-3-yl] 3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)benzoate |
| SMILES | CCOc1cc(C(=O)O[C@@H]2CCOC2=O)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C19H23NO8/c1-2-25-16-11-13(18(22)28-15-5-8-26-19(15)23)3-4-14(16)27-12-17(21)20-6-9-24-10-7-20/h3-4,11,15H,2,5-10,12H2,1H3/t15-/m1/s1 |
| InChIKey | GKPNHGZZZFGGIA-OAHLLOKOSA-N |
| XLogP | 0.80 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |