C14H17NO6 — CID 2363825
3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)benzoic acid (PubChem CID 2363825) has the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. Its IUPAC name is 3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)benzoic acid.
| Compound Name | 3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)benzoic acid |
|---|---|
| PubChem CID | 2363825 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)benzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C14H17NO6/c1-19-12-8-10(14(17)18)2-3-11(12)21-9-13(16)15-4-6-20-7-5-15/h2-3,8H,4-7,9H2,1H3,(H,17,18) |
| InChIKey | GKPUCROOEMQHEZ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |