C14H19N3O4S — CID 169358575
[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]thiourea (PubChem CID 169358575) has the molecular formula C14H19N3O4S and a molecular weight of 325.39 g/mol. Its IUPAC name is [3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]thiourea.
| Compound Name | [3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]thiourea |
|---|---|
| PubChem CID | 169358575 |
| Molecular Formula | C14H19N3O4S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | [3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]thiourea |
| SMILES | COc1cc(NC(N)=S)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C14H19N3O4S/c1-19-12-8-10(16-14(15)22)2-3-11(12)21-9-13(18)17-4-6-20-7-5-17/h2-3,8H,4-7,9H2,1H3,(H3,15,16,22) |
| InChIKey | UKMCEJWKGUSTEK-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|