C15H22N6O4 — CID 168604379
1-(diaminomethylidene)-2-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]guanidine (PubChem CID 168604379) has the molecular formula C15H22N6O4 and a molecular weight of 350.38 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 168604379 |
| Molecular Formula | C15H22N6O4 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 1-(diaminomethylidene)-2-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]guanidine |
| SMILES | COc1cc(/N=C(\N)N=C(N)N)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C15H22N6O4/c1-23-12-8-10(19-15(18)20-14(16)17)2-3-11(12)25-9-13(22)21-4-6-24-7-5-21/h2-3,8H,4-7,9H2,1H3,(H6,16,17,18,19,20) |
| InChIKey | TUPJFEXGPAUFCJ-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 150.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|