C15H21IN2O4 — CID 126537590
2-[4-[(iodomethylamino)methyl]-2-methoxyphenoxy]-1-morpholin-4-ylethanone (PubChem CID 126537590) has the molecular formula C15H21IN2O4 and a molecular weight of 420.25 g/mol. Its IUPAC name is 2-[4-[(iodomethylamino)methyl]-2-methoxyphenoxy]-1-morpholin-4-ylethanone.
| Compound Name | 2-[4-[(iodomethylamino)methyl]-2-methoxyphenoxy]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 126537590 |
| Molecular Formula | C15H21IN2O4 |
| Molecular Weight | 420.25 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | 2-[4-[(iodomethylamino)methyl]-2-methoxyphenoxy]-1-morpholin-4-ylethanone |
| SMILES | COc1cc(CNCI)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C15H21IN2O4/c1-20-14-8-12(9-17-11-16)2-3-13(14)22-10-15(19)18-4-6-21-7-5-18/h2-3,8,17H,4-7,9-11H2,1H3 |
| InChIKey | YSGPBLDNJXJDCB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.25 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|