C22H29N5O4 — CID 131938428
2-[2-methoxy-4-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]phenoxy]-1-morpholin-4-ylethanone (PubChem CID 131938428) has the molecular formula C22H29N5O4 and a molecular weight of 427.51 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]phenoxy]-1-morpholin-4-ylethanone.
| Compound Name | 2-[2-methoxy-4-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]phenoxy]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 131938428 |
| Molecular Formula | C22H29N5O4 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | 2-[2-methoxy-4-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]phenoxy]-1-morpholin-4-ylethanone |
| SMILES | COc1cc(CN2CCN(c3ncccn3)CC2)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C22H29N5O4/c1-29-20-15-18(3-4-19(20)31-17-21(28)26-11-13-30-14-12-26)16-25-7-9-27(10-8-25)22-23-5-2-6-24-22/h2-6,15H,7-14,16-17H2,1H3 |
| InChIKey | YAYOHEZCFAWSNB-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |