C23H29N3O4 — CID 131923008
2-[2-methoxy-4-[(2-pyridin-2-ylpyrrolidin-1-yl)methyl]phenoxy]-1-morpholin-4-ylethanone (PubChem CID 131923008) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(2-pyridin-2-ylpyrrolidin-1-yl)methyl]phenoxy]-1-morpholin-4-ylethanone.
| Compound Name | 2-[2-methoxy-4-[(2-pyridin-2-ylpyrrolidin-1-yl)methyl]phenoxy]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 131923008 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 2-[2-methoxy-4-[(2-pyridin-2-ylpyrrolidin-1-yl)methyl]phenoxy]-1-morpholin-4-ylethanone |
| SMILES | COc1cc(CN2CCCC2c2ccccn2)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C23H29N3O4/c1-28-22-15-18(16-26-10-4-6-20(26)19-5-2-3-9-24-19)7-8-21(22)30-17-23(27)25-11-13-29-14-12-25/h2-3,5,7-9,15,20H,4,6,10-14,16-17H2,1H3 |
| InChIKey | WEWDZTVUAPMNHU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |