C20H30N2O4 — CID 119123900
2-[2-methoxy-4-[[(2-methylcyclopentyl)amino]methyl]phenoxy]-1-morpholin-4-ylethanone (PubChem CID 119123900) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-[2-methoxy-4-[[(2-methylcyclopentyl)amino]methyl]phenoxy]-1-morpholin-4-ylethanone.
| Compound Name | 2-[2-methoxy-4-[[(2-methylcyclopentyl)amino]methyl]phenoxy]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 119123900 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 2-[2-methoxy-4-[[(2-methylcyclopentyl)amino]methyl]phenoxy]-1-morpholin-4-ylethanone |
| SMILES | COc1cc(CNC2CCCC2C)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C20H30N2O4/c1-15-4-3-5-17(15)21-13-16-6-7-18(19(12-16)24-2)26-14-20(23)22-8-10-25-11-9-22/h6-7,12,15,17,21H,3-5,8-11,13-14H2,1-2H3 |
| InChIKey | OMBBYPQHSMIVSB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |