C21H31N3O4 — CID 9012679
2-[4-[(Z)-[(2S,6R)-2,6-dimethylpiperidin-1-yl]iminomethyl]-2-methoxyphenoxy]-1-morpholin-4-ylethanone (PubChem CID 9012679) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is 2-[4-[(Z)-[(2S,6R)-2,6-dimethylpiperidin-1-yl]iminomethyl]-2-methoxyphenoxy]-1-morpholin-4-ylethanone.
| Compound Name | 2-[4-[(Z)-[(2S,6R)-2,6-dimethylpiperidin-1-yl]iminomethyl]-2-methoxyphenoxy]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 9012679 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | 2-[4-[(Z)-[(2S,6R)-2,6-dimethylpiperidin-1-yl]iminomethyl]-2-methoxyphenoxy]-1-morpholin-4-ylethanone |
| SMILES | COc1cc(/C=N\N2[C@H](C)CCC[C@@H]2C)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C21H31N3O4/c1-16-5-4-6-17(2)24(16)22-14-18-7-8-19(20(13-18)26-3)28-15-21(25)23-9-11-27-12-10-23/h7-8,13-14,16-17H,4-6,9-12,15H2,1-3H3/b22-14-/t16-,17+ |
| InChIKey | DFIPYGSCKWXVNV-UCGBDNTHSA-N |
| XLogP | 2.53 |
| TPSA | 63.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|