C21H22FN3O5 — CID 9016723
4-fluoro-N-[(Z)-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]benzamide (PubChem CID 9016723) has the molecular formula C21H22FN3O5 and a molecular weight of 415.42 g/mol. Its IUPAC name is 4-fluoro-N-[(Z)-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]benzamide.
| Compound Name | 4-fluoro-N-[(Z)-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 9016723 |
| Molecular Formula | C21H22FN3O5 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 4-fluoro-N-[(Z)-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]benzamide |
| SMILES | COc1cc(/C=N\NC(=O)c2ccc(F)cc2)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C21H22FN3O5/c1-28-19-12-15(13-23-24-21(27)16-3-5-17(22)6-4-16)2-7-18(19)30-14-20(26)25-8-10-29-11-9-25/h2-7,12-13H,8-11,14H2,1H3,(H,24,27)/b23-13- |
| InChIKey | QKWLJRISBGIZSI-QRVIBDJDSA-N |
| XLogP | 1.84 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|