C21H21Br2N3O6 — CID 126019355
3,5-dibromo-2-hydroxy-N-[(Z)-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]benzamide (PubChem CID 126019355) has the molecular formula C21H21Br2N3O6 and a molecular weight of 571.22 g/mol. Its IUPAC name is 3,5-dibromo-2-hydroxy-N-[(Z)-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]benzamide.
| Compound Name | 3,5-dibromo-2-hydroxy-N-[(Z)-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126019355 |
| Molecular Formula | C21H21Br2N3O6 |
| Molecular Weight | 571.22 g/mol |
| Exact Mass | 568.98 |
| IUPAC Name | 3,5-dibromo-2-hydroxy-N-[(Z)-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]benzamide |
| SMILES | COc1cc(/C=N\NC(=O)c2cc(Br)cc(Br)c2O)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C21H21Br2N3O6/c1-30-18-8-13(2-3-17(18)32-12-19(27)26-4-6-31-7-5-26)11-24-25-21(29)15-9-14(22)10-16(23)20(15)28/h2-3,8-11,28H,4-7,12H2,1H3,(H,25,29)/b24-11- |
| InChIKey | KLZFQUGZPYJONM-MYKKPKGFSA-N |
| XLogP | 2.93 |
| TPSA | 109.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.22 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|