C26H33N3O6 — CID 42992097
2-(4-tert-butylphenoxy)-N-[(E)-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]acetamide (PubChem CID 42992097) has the molecular formula C26H33N3O6 and a molecular weight of 483.57 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-N-[(E)-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]acetamide.
| Compound Name | 2-(4-tert-butylphenoxy)-N-[(E)-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 42992097 |
| Molecular Formula | C26H33N3O6 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-N-[(E)-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]acetamide |
| SMILES | COc1cc(/C=N/NC(=O)COc2ccc(C(C)(C)C)cc2)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C26H33N3O6/c1-26(2,3)20-6-8-21(9-7-20)34-17-24(30)28-27-16-19-5-10-22(23(15-19)32-4)35-18-25(31)29-11-13-33-14-12-29/h5-10,15-16H,11-14,17-18H2,1-4H3,(H,28,30)/b27-16+ |
| InChIKey | JAMIKLVQIKYDBD-JVWAILMASA-N |
| XLogP | 2.76 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|