C22H24IN3O6 — CID 126025224
4-iodo-3-methoxy-N-[(E)-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]benzamide (PubChem CID 126025224) has the molecular formula C22H24IN3O6 and a molecular weight of 553.35 g/mol. Its IUPAC name is 4-iodo-3-methoxy-N-[(E)-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]benzamide.
| Compound Name | 4-iodo-3-methoxy-N-[(E)-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126025224 |
| Molecular Formula | C22H24IN3O6 |
| Molecular Weight | 553.35 g/mol |
| Exact Mass | 553.07 |
| IUPAC Name | 4-iodo-3-methoxy-N-[(E)-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]benzamide |
| SMILES | COc1cc(C(=O)N/N=C/c2ccc(OCC(=O)N3CCOCC3)c(OC)c2)ccc1I |
| InChI | InChI=1S/C22H24IN3O6/c1-29-19-12-16(4-5-17(19)23)22(28)25-24-13-15-3-6-18(20(11-15)30-2)32-14-21(27)26-7-9-31-10-8-26/h3-6,11-13H,7-10,14H2,1-2H3,(H,25,28)/b24-13+ |
| InChIKey | XMLYGNXFQURLBM-ZMOGYAJESA-N |
| XLogP | 2.31 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|