C28H31N5O5S — CID 16556106
4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-N-[(E)-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]benzamide (PubChem CID 16556106) has the molecular formula C28H31N5O5S and a molecular weight of 549.65 g/mol. Its IUPAC name is 4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-N-[(E)-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]benzamide.
| Compound Name | 4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-N-[(E)-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 16556106 |
| Molecular Formula | C28H31N5O5S |
| Molecular Weight | 549.65 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | 4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-N-[(E)-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]benzamide |
| SMILES | COc1cc(/C=N/NC(=O)c2ccc(CSc3nc(C)cc(C)n3)cc2)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C28H31N5O5S/c1-19-14-20(2)31-28(30-19)39-18-21-4-7-23(8-5-21)27(35)32-29-16-22-6-9-24(25(15-22)36-3)38-17-26(34)33-10-12-37-13-11-33/h4-9,14-16H,10-13,17-18H2,1-3H3,(H,32,35)/b29-16+ |
| InChIKey | QXWHRRSSCIBZLK-MUFRIFMGSA-N |
| XLogP | 3.40 |
| TPSA | 115.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.65 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|