C25H34N8O4 — CID 126200051
2-[4-[(E)-[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-methoxyphenoxy]-1-morpholin-4-ylethanone (PubChem CID 126200051) has the molecular formula C25H34N8O4 and a molecular weight of 510.60 g/mol. Its IUPAC name is 2-[4-[(E)-[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-methoxyphenoxy]-1-morpholin-4-ylethanone.
| Compound Name | 2-[4-[(E)-[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-methoxyphenoxy]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 126200051 |
| Molecular Formula | C25H34N8O4 |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | 2-[4-[(E)-[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-methoxyphenoxy]-1-morpholin-4-ylethanone |
| SMILES | COc1cc(/C=N/Nc2nc(N3CCCC3)nc(N3CCCC3)n2)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C25H34N8O4/c1-35-21-16-19(6-7-20(21)37-18-22(34)31-12-14-36-15-13-31)17-26-30-23-27-24(32-8-2-3-9-32)29-25(28-23)33-10-4-5-11-33/h6-7,16-17H,2-5,8-15,18H2,1H3,(H,27,28,29,30)/b26-17+ |
| InChIKey | FPIWEBWIFKFLOD-YZSQISJMSA-N |
| XLogP | 1.76 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.60 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|