C22H31N7O4 — CID 5050991
N-[(3,4-diethoxyphenyl)methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine (PubChem CID 5050991) has the molecular formula C22H31N7O4 and a molecular weight of 457.54 g/mol. Its IUPAC name is N-[(3,4-diethoxyphenyl)methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine.
| Compound Name | N-[(3,4-diethoxyphenyl)methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 5050991 |
| Molecular Formula | C22H31N7O4 |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | N-[(3,4-diethoxyphenyl)methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
| SMILES | CCOc1ccc(C=NNc2nc(N3CCOCC3)nc(N3CCOCC3)n2)cc1OCC |
| InChI | InChI=1S/C22H31N7O4/c1-3-32-18-6-5-17(15-19(18)33-4-2)16-23-27-20-24-21(28-7-11-30-12-8-28)26-22(25-20)29-9-13-31-14-10-29/h5-6,15-16H,3-4,7-14H2,1-2H3,(H,24,25,26,27) |
| InChIKey | QXRUGTOAYJLIJX-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|