C23H27N7O3 — CID 6245512
2-N-[(Z)-(4-ethoxy-3-methoxyphenyl)methylideneamino]-6-morpholin-4-yl-4-N-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 6245512) has the molecular formula C23H27N7O3 and a molecular weight of 449.52 g/mol. Its IUPAC name is 2-N-[(Z)-(4-ethoxy-3-methoxyphenyl)methylideneamino]-6-morpholin-4-yl-4-N-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(Z)-(4-ethoxy-3-methoxyphenyl)methylideneamino]-6-morpholin-4-yl-4-N-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 6245512 |
| Molecular Formula | C23H27N7O3 |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 2-N-[(Z)-(4-ethoxy-3-methoxyphenyl)methylideneamino]-6-morpholin-4-yl-4-N-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCOc1ccc(/C=N\Nc2nc(Nc3ccccc3)nc(N3CCOCC3)n2)cc1OC |
| InChI | InChI=1S/C23H27N7O3/c1-3-33-19-10-9-17(15-20(19)31-2)16-24-29-22-26-21(25-18-7-5-4-6-8-18)27-23(28-22)30-11-13-32-14-12-30/h4-10,15-16H,3,11-14H2,1-2H3,(H2,25,26,27,28,29)/b24-16- |
| InChIKey | LEATVKGSTUNPLA-JLPGSUDCSA-N |
| XLogP | 3.31 |
| TPSA | 106.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|