C22H30N8O5 — CID 126207135
2-[4-[(E)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-ethoxyphenoxy]acetamide (PubChem CID 126207135) has the molecular formula C22H30N8O5 and a molecular weight of 486.53 g/mol. Its IUPAC name is 2-[4-[(E)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-ethoxyphenoxy]acetamide.
| Compound Name | 2-[4-[(E)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-ethoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 126207135 |
| Molecular Formula | C22H30N8O5 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | 2-[4-[(E)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-ethoxyphenoxy]acetamide |
| SMILES | CCOc1cc(/C=N/Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)ccc1OCC(N)=O |
| InChI | InChI=1S/C22H30N8O5/c1-2-34-18-13-16(3-4-17(18)35-15-19(23)31)14-24-28-20-25-21(29-5-9-32-10-6-29)27-22(26-20)30-7-11-33-12-8-30/h3-4,13-14H,2,5-12,15H2,1H3,(H2,23,31)(H,25,26,27,28)/b24-14+ |
| InChIKey | KINMCMLCAHEVDF-ZVHZXABRSA-N |
| XLogP | 0.25 |
| TPSA | 149.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|