C25H35N7O4 — CID 126208499
ethyl 2-[5-[(E)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetate (PubChem CID 126208499) has the molecular formula C25H35N7O4 and a molecular weight of 497.60 g/mol. Its IUPAC name is ethyl 2-[5-[(E)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[5-[(E)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126208499 |
| Molecular Formula | C25H35N7O4 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | ethyl 2-[5-[(E)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(/C=N/Nc2nc(N3CCCCC3)nc(N3CCCCC3)n2)ccc1OC |
| InChI | InChI=1S/C25H35N7O4/c1-3-35-22(33)18-36-21-16-19(10-11-20(21)34-2)17-26-30-23-27-24(31-12-6-4-7-13-31)29-25(28-23)32-14-8-5-9-15-32/h10-11,16-17H,3-9,12-15,18H2,1-2H3,(H,27,28,29,30)/b26-17+ |
| InChIKey | QNDUNIODVKOZPI-YZSQISJMSA-N |
| XLogP | 3.25 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|