C22H29N7O4 — CID 6010869
[4-[(Z)-[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2,6-dimethoxyphenyl] acetate (PubChem CID 6010869) has the molecular formula C22H29N7O4 and a molecular weight of 455.52 g/mol. Its IUPAC name is [4-[(Z)-[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2,6-dimethoxyphenyl] acetate.
| Compound Name | [4-[(Z)-[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2,6-dimethoxyphenyl] acetate |
|---|---|
| PubChem CID | 6010869 |
| Molecular Formula | C22H29N7O4 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | [4-[(Z)-[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2,6-dimethoxyphenyl] acetate |
| SMILES | COc1cc(/C=N\Nc2nc(N3CCCC3)nc(N3CCCC3)n2)cc(OC)c1OC(C)=O |
| InChI | InChI=1S/C22H29N7O4/c1-15(30)33-19-17(31-2)12-16(13-18(19)32-3)14-23-27-20-24-21(28-8-4-5-9-28)26-22(25-20)29-10-6-7-11-29/h12-14H,4-11H2,1-3H3,(H,24,25,26,27)/b23-14- |
| InChIKey | UVVOMALNABLRCW-UCQKPKSFSA-N |
| XLogP | 2.46 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|