C16H18N4O5 — CID 135824275
[2,6-dimethoxy-4-[(Z)-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenyl] acetate (PubChem CID 135824275) has the molecular formula C16H18N4O5 and a molecular weight of 346.34 g/mol. Its IUPAC name is [2,6-dimethoxy-4-[(Z)-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenyl] acetate.
| Compound Name | [2,6-dimethoxy-4-[(Z)-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 135824275 |
| Molecular Formula | C16H18N4O5 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | [2,6-dimethoxy-4-[(Z)-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenyl] acetate |
| SMILES | COc1cc(/C=N\Nc2nc(C)cc(=O)[nH]2)cc(OC)c1OC(C)=O |
| InChI | InChI=1S/C16H18N4O5/c1-9-5-14(22)19-16(18-9)20-17-8-11-6-12(23-3)15(25-10(2)21)13(7-11)24-4/h5-8H,1-4H3,(H2,18,19,20,22)/b17-8- |
| InChIKey | NAMLYVCQUQFGIE-IUXPMGMMSA-N |
| XLogP | 1.47 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|