C20H17N5O6 — CID 136740574
[2-methoxy-4-[(E)-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenyl] 3-nitrobenzoate (PubChem CID 136740574) has the molecular formula C20H17N5O6 and a molecular weight of 423.39 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenyl] 3-nitrobenzoate.
| Compound Name | [2-methoxy-4-[(E)-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenyl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 136740574 |
| Molecular Formula | C20H17N5O6 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | [2-methoxy-4-[(E)-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenyl] 3-nitrobenzoate |
| SMILES | COc1cc(/C=N/Nc2nc(C)cc(=O)[nH]2)ccc1OC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H17N5O6/c1-12-8-18(26)23-20(22-12)24-21-11-13-6-7-16(17(9-13)30-2)31-19(27)14-4-3-5-15(10-14)25(28)29/h3-11H,1-2H3,(H2,22,23,24,26)/b21-11+ |
| InChIKey | TWGMGFDPVMTQTJ-SRZZPIQSSA-N |
| XLogP | 2.66 |
| TPSA | 148.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|